C36H63N2O6P — CID 165274709
2-aminoethyl [(4E,8E)-3-hydroxy-2-[[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]amino]hexadeca-4,8-dienyl] hydrogen phosphate (PubChem CID 165274709) has the molecular formula C36H63N2O6P and a molecular weight of 650.88 g/mol. Its IUPAC name is 2-aminoethyl [(4E,8E)-3-hydroxy-2-[[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]amino]hexadeca-4,8-dienyl] hydrogen phosphate.
| Compound Name | 2-aminoethyl [(4E,8E)-3-hydroxy-2-[[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]amino]hexadeca-4,8-dienyl] hydrogen phosphate |
|---|---|
| PubChem CID | 165274709 |
| Molecular Formula | C36H63N2O6P |
| Molecular Weight | 650.88 g/mol |
| Exact Mass | 650.44 |
| IUPAC Name | 2-aminoethyl [(4E,8E)-3-hydroxy-2-[[(6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoyl]amino]hexadeca-4,8-dienyl] hydrogen phosphate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCCCC(=O)NC(COP(=O)(O)OCCN)C(O)/C=C/CC/C=C/CCCCCCC |
| InChI | InChI=1S/C36H63N2O6P/c1-3-5-7-9-11-13-15-16-17-18-20-22-24-26-28-30-36(40)38-34(33-44-45(41,42)43-32-31-37)35(39)29-27-25-23-21-19-14-12-10-8-6-4-2/h5,7,11,13,16-17,19-22,27,29,34-35,39H,3-4,6,8-10,12,14-15,18,23-26,28,30-33,37H2,1-2H3,(H,38,40)(H,41,42)/b7-5-,13-11-,17-16-,21-19+,22-20-,29-27+ |
| InChIKey | PKCDAXHWZCYOCS-IAGFXJIGSA-N |
| XLogP | 8.54 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.88 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|