C41H73N2O6P — CID 165241636
2-aminoethyl [(4E,8E)-3-hydroxy-2-[[(8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoyl]amino]nonadeca-4,8-dienyl] hydrogen phosphate (PubChem CID 165241636) has the molecular formula C41H73N2O6P and a molecular weight of 721.02 g/mol. Its IUPAC name is 2-aminoethyl [(4E,8E)-3-hydroxy-2-[[(8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoyl]amino]nonadeca-4,8-dienyl] hydrogen phosphate.
| Compound Name | 2-aminoethyl [(4E,8E)-3-hydroxy-2-[[(8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoyl]amino]nonadeca-4,8-dienyl] hydrogen phosphate |
|---|---|
| PubChem CID | 165241636 |
| Molecular Formula | C41H73N2O6P |
| Molecular Weight | 721.02 g/mol |
| Exact Mass | 720.52 |
| IUPAC Name | 2-aminoethyl [(4E,8E)-3-hydroxy-2-[[(8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoyl]amino]nonadeca-4,8-dienyl] hydrogen phosphate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCCCCCC(=O)NC(COP(=O)(O)OCCN)C(O)/C=C/CC/C=C/CCCCCCCCCC |
| InChI | InChI=1S/C41H73N2O6P/c1-3-5-7-9-11-13-15-17-19-20-21-23-25-27-29-31-33-35-41(45)43-39(38-49-50(46,47)48-37-36-42)40(44)34-32-30-28-26-24-22-18-16-14-12-10-8-6-4-2/h5,7,11,13,17,19,21,23-24,26,32,34,39-40,44H,3-4,6,8-10,12,14-16,18,20,22,25,27-31,33,35-38,42H2,1-2H3,(H,43,45)(H,46,47)/b7-5-,13-11-,19-17-,23-21-,26-24+,34-32+ |
| InChIKey | KIDYAAAQPSXMHQ-VWOXADOTSA-N |
| XLogP | 10.49 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.02 |
| LogP ≤ 5 | 10.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|