C44H75N2O6P — CID 165204059
2-aminoethyl [(4E,8E)-2-[[(8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoyl]amino]-3-hydroxyhexadeca-4,8-dienyl] hydrogen phosphate (PubChem CID 165204059) has the molecular formula C44H75N2O6P and a molecular weight of 759.07 g/mol. Its IUPAC name is 2-aminoethyl [(4E,8E)-2-[[(8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoyl]amino]-3-hydroxyhexadeca-4,8-dienyl] hydrogen phosphate.
| Compound Name | 2-aminoethyl [(4E,8E)-2-[[(8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoyl]amino]-3-hydroxyhexadeca-4,8-dienyl] hydrogen phosphate |
|---|---|
| PubChem CID | 165204059 |
| Molecular Formula | C44H75N2O6P |
| Molecular Weight | 759.07 g/mol |
| Exact Mass | 758.54 |
| IUPAC Name | 2-aminoethyl [(4E,8E)-2-[[(8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoyl]amino]-3-hydroxyhexadeca-4,8-dienyl] hydrogen phosphate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCCCC(=O)NC(COP(=O)(O)OCCN)C(O)/C=C/CC/C=C/CCCCCCC |
| InChI | InChI=1S/C44H75N2O6P/c1-3-5-7-9-11-13-15-16-17-18-19-20-21-22-23-24-25-26-28-30-32-34-36-38-44(48)46-42(41-52-53(49,50)51-40-39-45)43(47)37-35-33-31-29-27-14-12-10-8-6-4-2/h5,7,11,13,16-17,19-20,22-23,25-27,29,35,37,42-43,47H,3-4,6,8-10,12,14-15,18,21,24,28,30-34,36,38-41,45H2,1-2H3,(H,46,48)(H,49,50)/b7-5-,13-11-,17-16-,20-19-,23-22-,26-25-,29-27+,37-35+ |
| InChIKey | DOTJXSLGTCHPTH-MYWAAJMISA-N |
| XLogP | 11.22 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.07 |
| LogP ≤ 5 | 11.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|