C25H49N2O3+ — CID 142402364
[(5S)-6-methoxy-5-[[(Z)-octadec-9-enoyl]amino]-6-oxohexyl]azanium (PubChem CID 142402364) has the molecular formula C25H49N2O3+ and a molecular weight of 425.68 g/mol. Its IUPAC name is [(5S)-6-methoxy-5-[[(Z)-octadec-9-enoyl]amino]-6-oxohexyl]azanium.
| Compound Name | [(5S)-6-methoxy-5-[[(Z)-octadec-9-enoyl]amino]-6-oxohexyl]azanium |
|---|---|
| PubChem CID | 142402364 |
| Molecular Formula | C25H49N2O3+ |
| Molecular Weight | 425.68 g/mol |
| Exact Mass | 425.37 |
| IUPAC Name | [(5S)-6-methoxy-5-[[(Z)-octadec-9-enoyl]amino]-6-oxohexyl]azanium |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)N[C@@H](CCCC[NH3+])C(=O)OC |
| InChI | InChI=1S/C25H48N2O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21-24(28)27-23(25(29)30-2)20-18-19-22-26/h10-11,23H,3-9,12-22,26H2,1-2H3,(H,27,28)/p+1/b11-10-/t23-/m0/s1 |
| InChIKey | REFZSRIEBXIDLE-JCKUYFFHSA-O |
| XLogP | 5.09 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.68 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|