C40H75NO4 — CID 141478771
ethyl (Z)-2-[[(Z)-20-hydroxyicos-9-enoyl]amino]octadec-9-enoate (PubChem CID 141478771) has the molecular formula C40H75NO4 and a molecular weight of 634.04 g/mol. Its IUPAC name is ethyl (Z)-2-[[(Z)-20-hydroxyicos-9-enoyl]amino]octadec-9-enoate.
| Compound Name | ethyl (Z)-2-[[(Z)-20-hydroxyicos-9-enoyl]amino]octadec-9-enoate |
|---|---|
| PubChem CID | 141478771 |
| Molecular Formula | C40H75NO4 |
| Molecular Weight | 634.04 g/mol |
| Exact Mass | 633.57 |
| IUPAC Name | ethyl (Z)-2-[[(Z)-20-hydroxyicos-9-enoyl]amino]octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCC(NC(=O)CCCCCCC/C=C\CCCCCCCCCCO)C(=O)OCC |
| InChI | InChI=1S/C40H75NO4/c1-3-5-6-7-8-9-10-11-17-20-23-26-29-32-35-38(40(44)45-4-2)41-39(43)36-33-30-27-24-21-18-15-13-12-14-16-19-22-25-28-31-34-37-42/h11,13,15,17,38,42H,3-10,12,14,16,18-37H2,1-2H3,(H,41,43)/b15-13-,17-11- |
| InChIKey | YIZPSRHJKKNPOM-YUGIQPTDSA-N |
| XLogP | 11.47 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.04 |
| LogP ≤ 5 | 11.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|