C13H24N2O4 — CID 145415933
ethyl 5-amino-2-(hexanoylamino)-5-oxopentanoate (PubChem CID 145415933) has the molecular formula C13H24N2O4 and a molecular weight of 272.34 g/mol. Its IUPAC name is ethyl 5-amino-2-(hexanoylamino)-5-oxopentanoate.
| Compound Name | ethyl 5-amino-2-(hexanoylamino)-5-oxopentanoate |
|---|---|
| PubChem CID | 145415933 |
| Molecular Formula | C13H24N2O4 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | ethyl 5-amino-2-(hexanoylamino)-5-oxopentanoate |
| SMILES | CCCCCC(=O)NC(CCC(N)=O)C(=O)OCC |
| InChI | InChI=1S/C13H24N2O4/c1-3-5-6-7-12(17)15-10(8-9-11(14)16)13(18)19-4-2/h10H,3-9H2,1-2H3,(H2,14,16)(H,15,17) |
| InChIKey | MHDYDIQSAPKZFS-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|