C27H46N2O10 — CID 92532578
diethyl (2S)-2-[[9-[[(2R)-1,5-diethoxy-1,5-dioxopentan-2-yl]amino]-9-oxononanoyl]amino]pentanedioate (PubChem CID 92532578) has the molecular formula C27H46N2O10 and a molecular weight of 558.67 g/mol. Its IUPAC name is diethyl (2S)-2-[[9-[[(2R)-1,5-diethoxy-1,5-dioxopentan-2-yl]amino]-9-oxononanoyl]amino]pentanedioate.
| Compound Name | diethyl (2S)-2-[[9-[[(2R)-1,5-diethoxy-1,5-dioxopentan-2-yl]amino]-9-oxononanoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 92532578 |
| Molecular Formula | C27H46N2O10 |
| Molecular Weight | 558.67 g/mol |
| Exact Mass | 558.32 |
| IUPAC Name | diethyl (2S)-2-[[9-[[(2R)-1,5-diethoxy-1,5-dioxopentan-2-yl]amino]-9-oxononanoyl]amino]pentanedioate |
| SMILES | CCOC(=O)CC[C@H](NC(=O)CCCCCCCC(=O)N[C@H](CCC(=O)OCC)C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C27H46N2O10/c1-5-36-24(32)18-16-20(26(34)38-7-3)28-22(30)14-12-10-9-11-13-15-23(31)29-21(27(35)39-8-4)17-19-25(33)37-6-2/h20-21H,5-19H2,1-4H3,(H,28,30)(H,29,31)/t20-,21+ |
| InChIKey | WMIZMOTUQDMONP-OYRHEFFESA-N |
| XLogP | 2.50 |
| TPSA | 163.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.67 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|