C16H29BrN2O7 — CID 10527217
[(2S)-5-[[(2S)-1,5-diethoxy-1,5-dioxopentan-2-yl](15N)amino]-1-ethoxy-1,5-dioxopentan-2-yl](15N)azanium bromide (PubChem CID 10527217) has the molecular formula C16H29BrN2O7 and a molecular weight of 443.31 g/mol. Its IUPAC name is [(2S)-5-[[(2S)-1,5-diethoxy-1,5-dioxopentan-2-yl](15N)amino]-1-ethoxy-1,5-dioxopentan-2-yl](15N)azanium bromide.
| Compound Name | [(2S)-5-[[(2S)-1,5-diethoxy-1,5-dioxopentan-2-yl](15N)amino]-1-ethoxy-1,5-dioxopentan-2-yl](15N)azanium bromide |
|---|---|
| PubChem CID | 10527217 |
| Molecular Formula | C16H29BrN2O7 |
| Molecular Weight | 443.31 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | [(2S)-5-[[(2S)-1,5-diethoxy-1,5-dioxopentan-2-yl](15N)amino]-1-ethoxy-1,5-dioxopentan-2-yl](15N)azanium bromide |
| SMILES | CCOC(=O)CC[C@H]([15NH]C(=O)CC[C@H]([15NH3+])C(=O)OCC)C(=O)OCC.[Br-] |
| InChI | InChI=1S/C16H28N2O7.BrH/c1-4-23-14(20)10-8-12(16(22)25-6-3)18-13(19)9-7-11(17)15(21)24-5-2;/h11-12H,4-10,17H2,1-3H3,(H,18,19);1H/t11-,12-;/m0./s1/i17+1,18+1; |
| InChIKey | UJZGEUZOXUDCKF-QGYBJXLGSA-N |
| XLogP | -3.66 |
| TPSA | 135.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.31 |
| LogP ≤ 5 | -3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|