C15H29ClN2O6 — CID 10809078
[(2S)-5-[(1,5-diethoxy-1,5-dioxopentan-2-yl)amino]-1-methoxy-1-oxopentan-2-yl]azanium chloride (PubChem CID 10809078) has the molecular formula C15H29ClN2O6 and a molecular weight of 368.86 g/mol. Its IUPAC name is [(2S)-5-[(1,5-diethoxy-1,5-dioxopentan-2-yl)amino]-1-methoxy-1-oxopentan-2-yl]azanium chloride.
| Compound Name | [(2S)-5-[(1,5-diethoxy-1,5-dioxopentan-2-yl)amino]-1-methoxy-1-oxopentan-2-yl]azanium chloride |
|---|---|
| PubChem CID | 10809078 |
| Molecular Formula | C15H29ClN2O6 |
| Molecular Weight | 368.86 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | [(2S)-5-[(1,5-diethoxy-1,5-dioxopentan-2-yl)amino]-1-methoxy-1-oxopentan-2-yl]azanium chloride |
| SMILES | CCOC(=O)CCC(NCCC[C@H]([NH3+])C(=O)OC)C(=O)OCC.[Cl-] |
| InChI | InChI=1S/C15H28N2O6.ClH/c1-4-22-13(18)9-8-12(15(20)23-5-2)17-10-6-7-11(16)14(19)21-3;/h11-12,17H,4-10,16H2,1-3H3;1H/t11-,12?;/m0./s1 |
| InChIKey | CKSXONXQDREXAJ-YLIVSKOQSA-N |
| XLogP | -3.58 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.86 |
| LogP ≤ 5 | -3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|