C9H20N2O4+2 — CID 59280329
(6-azaniumyl-1,7-dimethoxy-1,7-dioxoheptan-2-yl)azanium (PubChem CID 59280329) has the molecular formula C9H20N2O4+2 and a molecular weight of 220.27 g/mol. Its IUPAC name is (6-azaniumyl-1,7-dimethoxy-1,7-dioxoheptan-2-yl)azanium.
| Compound Name | (6-azaniumyl-1,7-dimethoxy-1,7-dioxoheptan-2-yl)azanium |
|---|---|
| PubChem CID | 59280329 |
| Molecular Formula | C9H20N2O4+2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | (6-azaniumyl-1,7-dimethoxy-1,7-dioxoheptan-2-yl)azanium |
| SMILES | COC(=O)C([NH3+])CCCC([NH3+])C(=O)OC |
| InChI | InChI=1S/C9H18N2O4/c1-14-8(12)6(10)4-3-5-7(11)9(13)15-2/h6-7H,3-5,10-11H2,1-2H3/p+2 |
| InChIKey | UJSUWCBMTJCQAX-UHFFFAOYSA-P |
| XLogP | -2.28 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |