C8H20N4O2+2 — CID 9430167
[(5S)-5-azaniumyl-6-methoxy-6-oxohexyl]-(diaminomethylidene)azanium (PubChem CID 9430167) has the molecular formula C8H20N4O2+2 and a molecular weight of 204.27 g/mol. Its IUPAC name is [(5S)-5-azaniumyl-6-methoxy-6-oxohexyl]-(diaminomethylidene)azanium.
| Compound Name | [(5S)-5-azaniumyl-6-methoxy-6-oxohexyl]-(diaminomethylidene)azanium |
|---|---|
| PubChem CID | 9430167 |
| Molecular Formula | C8H20N4O2+2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | [(5S)-5-azaniumyl-6-methoxy-6-oxohexyl]-(diaminomethylidene)azanium |
| SMILES | COC(=O)[C@@H]([NH3+])CCCC[NH+]=C(N)N |
| InChI | InChI=1S/C8H18N4O2/c1-14-7(13)6(9)4-2-3-5-12-8(10)11/h6H,2-5,9H2,1H3,(H4,10,11,12)/p+2/t6-/m0/s1 |
| InChIKey | NBQATONWNUGXKD-LURJTMIESA-P |
| XLogP | -3.71 |
| TPSA | 119.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | -3.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|