C12H26N5O3+ — CID 6992562
(2S)-2-[[(2S)-2-azaniumyl-5-(diaminomethylideneazaniumyl)pentanoyl]amino]-4-methylpentanoate (PubChem CID 6992562) has the molecular formula C12H26N5O3+ and a molecular weight of 288.37 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-azaniumyl-5-(diaminomethylideneazaniumyl)pentanoyl]amino]-4-methylpentanoate.
| Compound Name | (2S)-2-[[(2S)-2-azaniumyl-5-(diaminomethylideneazaniumyl)pentanoyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 6992562 |
| Molecular Formula | C12H26N5O3+ |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | (2S)-2-[[(2S)-2-azaniumyl-5-(diaminomethylideneazaniumyl)pentanoyl]amino]-4-methylpentanoate |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H]([NH3+])CCC[NH+]=C(N)N)C(=O)[O-] |
| InChI | InChI=1S/C12H25N5O3/c1-7(2)6-9(11(19)20)17-10(18)8(13)4-3-5-16-12(14)15/h7-9H,3-6,13H2,1-2H3,(H,17,18)(H,19,20)(H4,14,15,16)/p+1/t8-,9-/m0/s1 |
| InChIKey | WYBVBIHNJWOLCJ-IUCAKERBSA-O |
| XLogP | -4.99 |
| TPSA | 162.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | -4.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|