C11H19N2O5- — CID 7009565
(2S)-2-[[(4S)-4-azaniumyl-4-carboxylatobutanoyl]amino]-4-methylpentanoate (PubChem CID 7009565) has the molecular formula C11H19N2O5- and a molecular weight of 259.28 g/mol. Its IUPAC name is (2S)-2-[[(4S)-4-azaniumyl-4-carboxylatobutanoyl]amino]-4-methylpentanoate.
| Compound Name | (2S)-2-[[(4S)-4-azaniumyl-4-carboxylatobutanoyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 7009565 |
| Molecular Formula | C11H19N2O5- |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | (2S)-2-[[(4S)-4-azaniumyl-4-carboxylatobutanoyl]amino]-4-methylpentanoate |
| SMILES | CC(C)C[C@H](NC(=O)CC[C@H]([NH3+])C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C11H20N2O5/c1-6(2)5-8(11(17)18)13-9(14)4-3-7(12)10(15)16/h6-8H,3-5,12H2,1-2H3,(H,13,14)(H,15,16)(H,17,18)/p-1/t7-,8-/m0/s1 |
| InChIKey | MYFMARDICOWMQP-YUMQZZPRSA-M |
| XLogP | -3.59 |
| TPSA | 137.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | -3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |