C15H29N3O5 — CID 23276218
2-[[2-[(2-azaniumyl-3-methylpentanoyl)amino]-3-hydroxypropanoyl]amino]-4-methylpentanoate (PubChem CID 23276218) has the molecular formula C15H29N3O5 and a molecular weight of 331.41 g/mol. Its IUPAC name is 2-[[2-[(2-azaniumyl-3-methylpentanoyl)amino]-3-hydroxypropanoyl]amino]-4-methylpentanoate.
| Compound Name | 2-[[2-[(2-azaniumyl-3-methylpentanoyl)amino]-3-hydroxypropanoyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 23276218 |
| Molecular Formula | C15H29N3O5 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | 2-[[2-[(2-azaniumyl-3-methylpentanoyl)amino]-3-hydroxypropanoyl]amino]-4-methylpentanoate |
| SMILES | CCC(C)C([NH3+])C(=O)NC(CO)C(=O)NC(CC(C)C)C(=O)[O-] |
| InChI | InChI=1S/C15H29N3O5/c1-5-9(4)12(16)14(21)18-11(7-19)13(20)17-10(15(22)23)6-8(2)3/h8-12,19H,5-7,16H2,1-4H3,(H,17,20)(H,18,21)(H,22,23) |
| InChIKey | PELCGFMHLZXWBQ-UHFFFAOYSA-N |
| XLogP | -2.60 |
| TPSA | 146.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |