C9H18N2O3 — CID 6992389
(2R)-2-[[(2R)-2-azaniumylpropanoyl]amino]-4-methylpentanoate (PubChem CID 6992389) has the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. Its IUPAC name is (2R)-2-[[(2R)-2-azaniumylpropanoyl]amino]-4-methylpentanoate.
| Compound Name | (2R)-2-[[(2R)-2-azaniumylpropanoyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 6992389 |
| Molecular Formula | C9H18N2O3 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | (2R)-2-[[(2R)-2-azaniumylpropanoyl]amino]-4-methylpentanoate |
| SMILES | CC(C)C[C@@H](NC(=O)[C@@H](C)[NH3+])C(=O)[O-] |
| InChI | InChI=1S/C9H18N2O3/c1-5(2)4-7(9(13)14)11-8(12)6(3)10/h5-7H,4,10H2,1-3H3,(H,11,12)(H,13,14)/t6-,7-/m1/s1 |
| InChIKey | RDIKFPRVLJLMER-RNFRBKRXSA-N |
| XLogP | -2.10 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |