C12H21N2O3- — CID 6956773
(2S)-2-(cyclopentylcarbamoylamino)-4-methylpentanoate (PubChem CID 6956773) has the molecular formula C12H21N2O3- and a molecular weight of 241.31 g/mol. Its IUPAC name is (2S)-2-(cyclopentylcarbamoylamino)-4-methylpentanoate.
| Compound Name | (2S)-2-(cyclopentylcarbamoylamino)-4-methylpentanoate |
|---|---|
| PubChem CID | 6956773 |
| Molecular Formula | C12H21N2O3- |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | (2S)-2-(cyclopentylcarbamoylamino)-4-methylpentanoate |
| SMILES | CC(C)C[C@H](NC(=O)NC1CCCC1)C(=O)[O-] |
| InChI | InChI=1S/C12H22N2O3/c1-8(2)7-10(11(15)16)14-12(17)13-9-5-3-4-6-9/h8-10H,3-7H2,1-2H3,(H,15,16)(H2,13,14,17)/p-1/t10-/m0/s1 |
| InChIKey | MMHFDPOBJWIMIH-JTQLQIEISA-M |
| XLogP | 0.39 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |