C13H27ClN2O — CID 163408455
(2S)-N-cyclohexyl-4-methyl-2-(methylamino)pentanamide;hydrochloride (PubChem CID 163408455) has the molecular formula C13H27ClN2O and a molecular weight of 262.82 g/mol. Its IUPAC name is (2S)-N-cyclohexyl-4-methyl-2-(methylamino)pentanamide;hydrochloride.
| Compound Name | (2S)-N-cyclohexyl-4-methyl-2-(methylamino)pentanamide;hydrochloride |
|---|---|
| PubChem CID | 163408455 |
| Molecular Formula | C13H27ClN2O |
| Molecular Weight | 262.82 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | (2S)-N-cyclohexyl-4-methyl-2-(methylamino)pentanamide;hydrochloride |
| SMILES | CN[C@@H](CC(C)C)C(=O)NC1CCCCC1.Cl |
| InChI | InChI=1S/C13H26N2O.ClH/c1-10(2)9-12(14-3)13(16)15-11-7-5-4-6-8-11;/h10-12,14H,4-9H2,1-3H3,(H,15,16);1H/t12-;/m0./s1 |
| InChIKey | ZVWKSLRCFQKBBC-YDALLXLXSA-N |
| XLogP | 2.49 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.82 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |