C12H25ClN2O — CID 119674669
N-cycloheptyl-2-methyl-3-(methylamino)propanamide;hydrochloride (PubChem CID 119674669) has the molecular formula C12H25ClN2O and a molecular weight of 248.80 g/mol. Its IUPAC name is N-cycloheptyl-2-methyl-3-(methylamino)propanamide;hydrochloride.
| Compound Name | N-cycloheptyl-2-methyl-3-(methylamino)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119674669 |
| Molecular Formula | C12H25ClN2O |
| Molecular Weight | 248.80 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | N-cycloheptyl-2-methyl-3-(methylamino)propanamide;hydrochloride |
| SMILES | CNCC(C)C(=O)NC1CCCCCC1.Cl |
| InChI | InChI=1S/C12H24N2O.ClH/c1-10(9-13-2)12(15)14-11-7-5-3-4-6-8-11;/h10-11,13H,3-9H2,1-2H3,(H,14,15);1H |
| InChIKey | YQJARBTZSCCXNV-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.80 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |