C14H29ClN2O — CID 119775861
2-methyl-3-(methylamino)-N-(3-propan-2-ylcyclohexyl)propanamide;hydrochloride (PubChem CID 119775861) has the molecular formula C14H29ClN2O and a molecular weight of 276.85 g/mol. Its IUPAC name is 2-methyl-3-(methylamino)-N-(3-propan-2-ylcyclohexyl)propanamide;hydrochloride.
| Compound Name | 2-methyl-3-(methylamino)-N-(3-propan-2-ylcyclohexyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119775861 |
| Molecular Formula | C14H29ClN2O |
| Molecular Weight | 276.85 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | 2-methyl-3-(methylamino)-N-(3-propan-2-ylcyclohexyl)propanamide;hydrochloride |
| SMILES | CNCC(C)C(=O)NC1CCCC(C(C)C)C1.Cl |
| InChI | InChI=1S/C14H28N2O.ClH/c1-10(2)12-6-5-7-13(8-12)16-14(17)11(3)9-15-4;/h10-13,15H,5-9H2,1-4H3,(H,16,17);1H |
| InChIKey | DRXXYCMBQKBMIT-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.85 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |