C16H32N2O — CID 107448285
N,4-dimethyl-2-[(3-propan-2-ylcyclohexyl)amino]pentanamide (PubChem CID 107448285) has the molecular formula C16H32N2O and a molecular weight of 268.44 g/mol. Its IUPAC name is N,4-dimethyl-2-[(3-propan-2-ylcyclohexyl)amino]pentanamide.
| Compound Name | N,4-dimethyl-2-[(3-propan-2-ylcyclohexyl)amino]pentanamide |
|---|---|
| PubChem CID | 107448285 |
| Molecular Formula | C16H32N2O |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.25 |
| IUPAC Name | N,4-dimethyl-2-[(3-propan-2-ylcyclohexyl)amino]pentanamide |
| SMILES | CNC(=O)C(CC(C)C)NC1CCCC(C(C)C)C1 |
| InChI | InChI=1S/C16H32N2O/c1-11(2)9-15(16(19)17-5)18-14-8-6-7-13(10-14)12(3)4/h11-15,18H,6-10H2,1-5H3,(H,17,19) |
| InChIKey | CIGIEDCYGXRHIB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |