C19H29ClN2O — CID 132571850
2-[(4-chlorophenyl)methylamino]-N-cyclohexyl-4-methylpentanamide (PubChem CID 132571850) has the molecular formula C19H29ClN2O and a molecular weight of 336.91 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methylamino]-N-cyclohexyl-4-methylpentanamide.
| Compound Name | 2-[(4-chlorophenyl)methylamino]-N-cyclohexyl-4-methylpentanamide |
|---|---|
| PubChem CID | 132571850 |
| Molecular Formula | C19H29ClN2O |
| Molecular Weight | 336.91 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 2-[(4-chlorophenyl)methylamino]-N-cyclohexyl-4-methylpentanamide |
| SMILES | CC(C)CC(NCc1ccc(Cl)cc1)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C19H29ClN2O/c1-14(2)12-18(19(23)22-17-6-4-3-5-7-17)21-13-15-8-10-16(20)11-9-15/h8-11,14,17-18,21H,3-7,12-13H2,1-2H3,(H,22,23) |
| InChIKey | AAIUTEAZNKUUPO-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.91 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |