C20H36N2O2 — CID 40516545
N-[(2S)-4-methyl-1-[(4-methylcyclohexyl)amino]-1-oxopentan-2-yl]cyclohexanecarboxamide (PubChem CID 40516545) has the molecular formula C20H36N2O2 and a molecular weight of 336.52 g/mol. Its IUPAC name is N-[(2S)-4-methyl-1-[(4-methylcyclohexyl)amino]-1-oxopentan-2-yl]cyclohexanecarboxamide.
| Compound Name | N-[(2S)-4-methyl-1-[(4-methylcyclohexyl)amino]-1-oxopentan-2-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 40516545 |
| Molecular Formula | C20H36N2O2 |
| Molecular Weight | 336.52 g/mol |
| Exact Mass | 336.28 |
| IUPAC Name | N-[(2S)-4-methyl-1-[(4-methylcyclohexyl)amino]-1-oxopentan-2-yl]cyclohexanecarboxamide |
| SMILES | CC(C)C[C@H](NC(=O)C1CCCCC1)C(=O)NC1CCC(C)CC1 |
| InChI | InChI=1S/C20H36N2O2/c1-14(2)13-18(22-19(23)16-7-5-4-6-8-16)20(24)21-17-11-9-15(3)10-12-17/h14-18H,4-13H2,1-3H3,(H,21,24)(H,22,23)/t15?,17?,18-/m0/s1 |
| InChIKey | RILGBGGCJKTTEN-VJFUWPCTSA-N |
| XLogP | 3.79 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.52 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |