C20H34N2O4 — CID 119361412
(2S)-2-[[4-[(2-cyclopentylacetyl)amino]cyclohexanecarbonyl]amino]-4-methylpentanoic acid (PubChem CID 119361412) has the molecular formula C20H34N2O4 and a molecular weight of 366.50 g/mol. Its IUPAC name is (2S)-2-[[4-[(2-cyclopentylacetyl)amino]cyclohexanecarbonyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[4-[(2-cyclopentylacetyl)amino]cyclohexanecarbonyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 119361412 |
| Molecular Formula | C20H34N2O4 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.25 |
| IUPAC Name | (2S)-2-[[4-[(2-cyclopentylacetyl)amino]cyclohexanecarbonyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)C1CCC(NC(=O)CC2CCCC2)CC1)C(=O)O |
| InChI | InChI=1S/C20H34N2O4/c1-13(2)11-17(20(25)26)22-19(24)15-7-9-16(10-8-15)21-18(23)12-14-5-3-4-6-14/h13-17H,3-12H2,1-2H3,(H,21,23)(H,22,24)(H,25,26)/t15?,16?,17-/m0/s1 |
| InChIKey | BRKWTNROAKLRDR-JCYILVPMSA-N |
| XLogP | 2.86 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |