C21H36N2O4 — CID 119360995
(2S)-2-[[4-[(2-cyclohexylacetyl)amino]cyclohexanecarbonyl]amino]-4-methylpentanoic acid (PubChem CID 119360995) has the molecular formula C21H36N2O4 and a molecular weight of 380.53 g/mol. Its IUPAC name is (2S)-2-[[4-[(2-cyclohexylacetyl)amino]cyclohexanecarbonyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[4-[(2-cyclohexylacetyl)amino]cyclohexanecarbonyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 119360995 |
| Molecular Formula | C21H36N2O4 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | (2S)-2-[[4-[(2-cyclohexylacetyl)amino]cyclohexanecarbonyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)C1CCC(NC(=O)CC2CCCCC2)CC1)C(=O)O |
| InChI | InChI=1S/C21H36N2O4/c1-14(2)12-18(21(26)27)23-20(25)16-8-10-17(11-9-16)22-19(24)13-15-6-4-3-5-7-15/h14-18H,3-13H2,1-2H3,(H,22,24)(H,23,25)(H,26,27)/t16?,17?,18-/m0/s1 |
| InChIKey | QCOWNOALLRWNGG-ABHNRTSZSA-N |
| XLogP | 3.25 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |