C11H21N2O3- — CID 7680380
(2R)-4-methyl-2-(2-methylpropylcarbamoylamino)pentanoate (PubChem CID 7680380) has the molecular formula C11H21N2O3- and a molecular weight of 229.30 g/mol. Its IUPAC name is (2R)-4-methyl-2-(2-methylpropylcarbamoylamino)pentanoate.
| Compound Name | (2R)-4-methyl-2-(2-methylpropylcarbamoylamino)pentanoate |
|---|---|
| PubChem CID | 7680380 |
| Molecular Formula | C11H21N2O3- |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | (2R)-4-methyl-2-(2-methylpropylcarbamoylamino)pentanoate |
| SMILES | CC(C)CNC(=O)N[C@H](CC(C)C)C(=O)[O-] |
| InChI | InChI=1S/C11H22N2O3/c1-7(2)5-9(10(14)15)13-11(16)12-6-8(3)4/h7-9H,5-6H2,1-4H3,(H,14,15)(H2,12,13,16)/p-1/t9-/m1/s1 |
| InChIKey | MZMUKISMJUPIQP-SECBINFHSA-M |
| XLogP | 0.11 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |