C15H21N2O3- — CID 6956422
(2S)-2-[(2,3-dimethylphenyl)carbamoylamino]-4-methylpentanoate (PubChem CID 6956422) has the molecular formula C15H21N2O3- and a molecular weight of 277.34 g/mol. Its IUPAC name is (2S)-2-[(2,3-dimethylphenyl)carbamoylamino]-4-methylpentanoate.
| Compound Name | (2S)-2-[(2,3-dimethylphenyl)carbamoylamino]-4-methylpentanoate |
|---|---|
| PubChem CID | 6956422 |
| Molecular Formula | C15H21N2O3- |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | (2S)-2-[(2,3-dimethylphenyl)carbamoylamino]-4-methylpentanoate |
| SMILES | Cc1cccc(NC(=O)N[C@@H](CC(C)C)C(=O)[O-])c1C |
| InChI | InChI=1S/C15H22N2O3/c1-9(2)8-13(14(18)19)17-15(20)16-12-7-5-6-10(3)11(12)4/h5-7,9,13H,8H2,1-4H3,(H,18,19)(H2,16,17,20)/p-1/t13-/m0/s1 |
| InChIKey | LMZRCCNEHDUAGW-ZDUSSCGKSA-M |
| XLogP | 1.59 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |