2-[(2,3-dimethylphenyl)carbamoylamino]-3-hydroxybutanoic acid

C13H18N2O4 — CID 61200115

IUPAC2-[(2,3-dimethylphenyl)carbamoylamino]-3-hydroxybutanoic acid
SMILESCc1cccc(NC(=O)NC(C(=O)O)C(C)O)c1C
InChIInChI=1S/C13H18N2O4/c1-7-5-4-6-10(8(7)2)14-13(19)15-11(9(3)16)12(17)18/h4-6,9,11,16H,1-3H3,(H,17,18)(H2,14,15,19)
InChIKeyHYDQMSFCBSGLRA-UHFFFAOYSA-N
MW266.30 g/mol
LogP1.26
Rot. Bonds4

About 2-[(2,3-dimethylphenyl)carbamoylamino]-3-hydroxybutanoic acid

2-[(2,3-dimethylphenyl)carbamoylamino]-3-hydroxybutanoic acid (PubChem CID 61200115) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is 2-[(2,3-dimethylphenyl)carbamoylamino]-3-hydroxybutanoic acid.

Molecular Properties

Compound Name2-[(2,3-dimethylphenyl)carbamoylamino]-3-hydroxybutanoic acid
PubChem CID61200115
Molecular FormulaC13H18N2O4
Molecular Weight266.30 g/mol
Exact Mass266.13
IUPAC Name2-[(2,3-dimethylphenyl)carbamoylamino]-3-hydroxybutanoic acid
SMILESCc1cccc(NC(=O)NC(C(=O)O)C(C)O)c1C
InChIInChI=1S/C13H18N2O4/c1-7-5-4-6-10(8(7)2)14-13(19)15-11(9(3)16)12(17)18/h4-6,9,11,16H,1-3H3,(H,17,18)(H2,14,15,19)
InChIKeyHYDQMSFCBSGLRA-UHFFFAOYSA-N
XLogP1.26
TPSA98.66 Ų
H-Bond Donors4
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.30
LogP ≤ 51.26
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 103

Analyze 2-[(2,3-dimethylphenyl)carbamoylamino]-3-hydroxybutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2,3-dimethylphenyl)carbamoylamino]-3-hydroxybutanoic acid?
The IUPAC name of 2-[(2,3-dimethylphenyl)carbamoylamino]-3-hydroxybutanoic acid (CID 61200115) is 2-[(2,3-dimethylphenyl)carbamoylamino]-3-hydroxybutanoic acid.
What is the SMILES notation for 2-[(2,3-dimethylphenyl)carbamoylamino]-3-hydroxybutanoic acid?
The canonical SMILES for 2-[(2,3-dimethylphenyl)carbamoylamino]-3-hydroxybutanoic acid is Cc1cccc(NC(=O)NC(C(=O)O)C(C)O)c1C.
What is the InChIKey of 2-[(2,3-dimethylphenyl)carbamoylamino]-3-hydroxybutanoic acid?
The InChIKey is HYDQMSFCBSGLRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O4/c1-7-5-4-6-10(8(7)2)14-13(19)15-11(9(3)16)12(17)18/h4-6,9,11,16H,1-3H3,(H,17,18)(H2,14,15,19).
What are the key properties of 2-[(2,3-dimethylphenyl)carbamoylamino]-3-hydroxybutanoic acid?
2-[(2,3-dimethylphenyl)carbamoylamino]-3-hydroxybutanoic acid has a molecular weight of 266.30 g/mol, XLogP of 1.26, 4 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,3-dimethylphenyl)carbamoylamino]-3-hydroxybutanoic acid is sourced from PubChem (CID 61200115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).