C13H18N2O4 — CID 61200115
2-[(2,3-dimethylphenyl)carbamoylamino]-3-hydroxybutanoic acid (PubChem CID 61200115) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is 2-[(2,3-dimethylphenyl)carbamoylamino]-3-hydroxybutanoic acid.
| Compound Name | 2-[(2,3-dimethylphenyl)carbamoylamino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 61200115 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 2-[(2,3-dimethylphenyl)carbamoylamino]-3-hydroxybutanoic acid |
| SMILES | Cc1cccc(NC(=O)NC(C(=O)O)C(C)O)c1C |
| InChI | InChI=1S/C13H18N2O4/c1-7-5-4-6-10(8(7)2)14-13(19)15-11(9(3)16)12(17)18/h4-6,9,11,16H,1-3H3,(H,17,18)(H2,14,15,19) |
| InChIKey | HYDQMSFCBSGLRA-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |