C11H12Br2N2O4 — CID 104966010
(2S,3R)-2-[(2,5-dibromophenyl)carbamoylamino]-3-hydroxybutanoic acid (PubChem CID 104966010) has the molecular formula C11H12Br2N2O4 and a molecular weight of 396.04 g/mol. Its IUPAC name is (2S,3R)-2-[(2,5-dibromophenyl)carbamoylamino]-3-hydroxybutanoic acid.
| Compound Name | (2S,3R)-2-[(2,5-dibromophenyl)carbamoylamino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 104966010 |
| Molecular Formula | C11H12Br2N2O4 |
| Molecular Weight | 396.04 g/mol |
| Exact Mass | 393.92 |
| IUPAC Name | (2S,3R)-2-[(2,5-dibromophenyl)carbamoylamino]-3-hydroxybutanoic acid |
| SMILES | C[C@@H](O)[C@H](NC(=O)Nc1cc(Br)ccc1Br)C(=O)O |
| InChI | InChI=1S/C11H12Br2N2O4/c1-5(16)9(10(17)18)15-11(19)14-8-4-6(12)2-3-7(8)13/h2-5,9,16H,1H3,(H,17,18)(H2,14,15,19)/t5-,9+/m1/s1 |
| InChIKey | YXZJSWNINFSPKV-ANLVUFKYSA-N |
| XLogP | 2.17 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.04 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |