C11H14Br2N2O — CID 51945845
1-[(2R)-butan-2-yl]-3-(2,5-dibromophenyl)urea (PubChem CID 51945845) has the molecular formula C11H14Br2N2O and a molecular weight of 350.05 g/mol. Its IUPAC name is 1-[(2R)-butan-2-yl]-3-(2,5-dibromophenyl)urea.
| Compound Name | 1-[(2R)-butan-2-yl]-3-(2,5-dibromophenyl)urea |
|---|---|
| PubChem CID | 51945845 |
| Molecular Formula | C11H14Br2N2O |
| Molecular Weight | 350.05 g/mol |
| Exact Mass | 347.95 |
| IUPAC Name | 1-[(2R)-butan-2-yl]-3-(2,5-dibromophenyl)urea |
| SMILES | CC[C@@H](C)NC(=O)Nc1cc(Br)ccc1Br |
| InChI | InChI=1S/C11H14Br2N2O/c1-3-7(2)14-11(16)15-10-6-8(12)4-5-9(10)13/h4-7H,3H2,1-2H3,(H2,14,15,16)/t7-/m1/s1 |
| InChIKey | JNCVDPVPYPOKHE-SSDOTTSWSA-N |
| XLogP | 4.13 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.05 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |