2-[[(2,5-dibromophenyl)carbamoylamino]methyl]butanoic acid

C12H14Br2N2O3 — CID 65223594

IUPAC2-[[(2,5-dibromophenyl)carbamoylamino]methyl]butanoic acid
SMILESCCC(CNC(=O)Nc1cc(Br)ccc1Br)C(=O)O
InChIInChI=1S/C12H14Br2N2O3/c1-2-7(11(17)18)6-15-12(19)16-10-5-8(13)3-4-9(10)14/h3-5,7H,2,6H2,1H3,(H,17,18)(H2,15,16,19)
InChIKeyYBFOAQUUHLYXCS-UHFFFAOYSA-N
MW394.06 g/mol
LogP3.44
Rot. Bonds5

About 2-[[(2,5-dibromophenyl)carbamoylamino]methyl]butanoic acid

2-[[(2,5-dibromophenyl)carbamoylamino]methyl]butanoic acid (PubChem CID 65223594) has the molecular formula C12H14Br2N2O3 and a molecular weight of 394.06 g/mol. Its IUPAC name is 2-[[(2,5-dibromophenyl)carbamoylamino]methyl]butanoic acid.

Molecular Properties

Compound Name2-[[(2,5-dibromophenyl)carbamoylamino]methyl]butanoic acid
PubChem CID65223594
Molecular FormulaC12H14Br2N2O3
Molecular Weight394.06 g/mol
Exact Mass391.94
IUPAC Name2-[[(2,5-dibromophenyl)carbamoylamino]methyl]butanoic acid
SMILESCCC(CNC(=O)Nc1cc(Br)ccc1Br)C(=O)O
InChIInChI=1S/C12H14Br2N2O3/c1-2-7(11(17)18)6-15-12(19)16-10-5-8(13)3-4-9(10)14/h3-5,7H,2,6H2,1H3,(H,17,18)(H2,15,16,19)
InChIKeyYBFOAQUUHLYXCS-UHFFFAOYSA-N
XLogP3.44
TPSA78.43 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500394.06
LogP ≤ 53.44
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Analyze 2-[[(2,5-dibromophenyl)carbamoylamino]methyl]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[[(2,5-dibromophenyl)carbamoylamino]methyl]butanoic acid?
The IUPAC name of 2-[[(2,5-dibromophenyl)carbamoylamino]methyl]butanoic acid (CID 65223594) is 2-[[(2,5-dibromophenyl)carbamoylamino]methyl]butanoic acid.
What is the SMILES notation for 2-[[(2,5-dibromophenyl)carbamoylamino]methyl]butanoic acid?
The canonical SMILES for 2-[[(2,5-dibromophenyl)carbamoylamino]methyl]butanoic acid is CCC(CNC(=O)Nc1cc(Br)ccc1Br)C(=O)O.
What is the InChIKey of 2-[[(2,5-dibromophenyl)carbamoylamino]methyl]butanoic acid?
The InChIKey is YBFOAQUUHLYXCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14Br2N2O3/c1-2-7(11(17)18)6-15-12(19)16-10-5-8(13)3-4-9(10)14/h3-5,7H,2,6H2,1H3,(H,17,18)(H2,15,16,19).
What are the key properties of 2-[[(2,5-dibromophenyl)carbamoylamino]methyl]butanoic acid?
2-[[(2,5-dibromophenyl)carbamoylamino]methyl]butanoic acid has a molecular weight of 394.06 g/mol, XLogP of 3.44, 5 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(2,5-dibromophenyl)carbamoylamino]methyl]butanoic acid is sourced from PubChem (CID 65223594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).