C13H16Br2N2O3 — CID 82688853
5-[(2,5-dibromophenyl)carbamoylamino]-4-methylpentanoic acid (PubChem CID 82688853) has the molecular formula C13H16Br2N2O3 and a molecular weight of 408.09 g/mol. Its IUPAC name is 5-[(2,5-dibromophenyl)carbamoylamino]-4-methylpentanoic acid.
| Compound Name | 5-[(2,5-dibromophenyl)carbamoylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 82688853 |
| Molecular Formula | C13H16Br2N2O3 |
| Molecular Weight | 408.09 g/mol |
| Exact Mass | 405.95 |
| IUPAC Name | 5-[(2,5-dibromophenyl)carbamoylamino]-4-methylpentanoic acid |
| SMILES | CC(CCC(=O)O)CNC(=O)Nc1cc(Br)ccc1Br |
| InChI | InChI=1S/C13H16Br2N2O3/c1-8(2-5-12(18)19)7-16-13(20)17-11-6-9(14)3-4-10(11)15/h3-4,6,8H,2,5,7H2,1H3,(H,18,19)(H2,16,17,20) |
| InChIKey | LKUGXMPSZUFEBR-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.09 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |