C6H10NO4- — CID 6971090
(2S,4S)-2-azaniumyl-4-methylpentanedioate (PubChem CID 6971090) has the molecular formula C6H10NO4- and a molecular weight of 160.15 g/mol. Its IUPAC name is (2S,4S)-2-azaniumyl-4-methylpentanedioate.
| Compound Name | (2S,4S)-2-azaniumyl-4-methylpentanedioate |
|---|---|
| PubChem CID | 6971090 |
| Molecular Formula | C6H10NO4- |
| Molecular Weight | 160.15 g/mol |
| Exact Mass | 160.06 |
| IUPAC Name | (2S,4S)-2-azaniumyl-4-methylpentanedioate |
| SMILES | C[C@@H](C[C@H]([NH3+])C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C6H11NO4/c1-3(5(8)9)2-4(7)6(10)11/h3-4H,2,7H2,1H3,(H,8,9)(H,10,11)/p-1/t3-,4-/m0/s1 |
| InChIKey | KRKRAOXTGDJWNI-IMJSIDKUSA-M |
| XLogP | -3.88 |
| TPSA | 107.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.15 |
| LogP ≤ 5 | -3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |