C5H11NO2S — CID 5255805
2-azaniumyl-4-methylsulfanylbutanoate (PubChem CID 5255805) has the molecular formula C5H11NO2S and a molecular weight of 149.22 g/mol. Its IUPAC name is 2-azaniumyl-4-methylsulfanylbutanoate.
| Compound Name | 2-azaniumyl-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 5255805 |
| Molecular Formula | C5H11NO2S |
| Molecular Weight | 149.22 g/mol |
| Exact Mass | 149.05 |
| IUPAC Name | 2-azaniumyl-4-methylsulfanylbutanoate |
| SMILES | CSCCC([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C5H11NO2S/c1-9-3-2-4(6)5(7)8/h4H,2-3,6H2,1H3,(H,7,8) |
| InChIKey | FFEARJCKVFRZRR-UHFFFAOYSA-N |
| XLogP | -1.90 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.22 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |