C14H22N2O4S — CID 139060676
(2R)-2-azaniumyl-4-methylsulfanylbutanoate;(2S)-2-azaniumyl-3-phenylpropanoate (PubChem CID 139060676) has the molecular formula C14H22N2O4S and a molecular weight of 314.41 g/mol. Its IUPAC name is (2R)-2-azaniumyl-4-methylsulfanylbutanoate;(2S)-2-azaniumyl-3-phenylpropanoate.
| Compound Name | (2R)-2-azaniumyl-4-methylsulfanylbutanoate;(2S)-2-azaniumyl-3-phenylpropanoate |
|---|---|
| PubChem CID | 139060676 |
| Molecular Formula | C14H22N2O4S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | (2R)-2-azaniumyl-4-methylsulfanylbutanoate;(2S)-2-azaniumyl-3-phenylpropanoate |
| SMILES | CSCC[C@@H]([NH3+])C(=O)[O-].[NH3+][C@@H](Cc1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C9H11NO2.C5H11NO2S/c10-8(9(11)12)6-7-4-2-1-3-5-7;1-9-3-2-4(6)5(7)8/h1-5,8H,6,10H2,(H,11,12);4H,2-3,6H2,1H3,(H,7,8)/t8-;4-/m01/s1 |
| InChIKey | GQYAUZAWKROOLF-ISITULPFSA-N |
| XLogP | -3.31 |
| TPSA | 135.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | -3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |