C9H15NO7 — CID 139195737
(2S)-2-azaniumyl-3-(4-hydroxyphenyl)propanoate;hydrogen peroxide (PubChem CID 139195737) has the molecular formula C9H15NO7 and a molecular weight of 249.22 g/mol. Its IUPAC name is (2S)-2-azaniumyl-3-(4-hydroxyphenyl)propanoate;hydrogen peroxide.
| Compound Name | (2S)-2-azaniumyl-3-(4-hydroxyphenyl)propanoate;hydrogen peroxide |
|---|---|
| PubChem CID | 139195737 |
| Molecular Formula | C9H15NO7 |
| Molecular Weight | 249.22 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | (2S)-2-azaniumyl-3-(4-hydroxyphenyl)propanoate;hydrogen peroxide |
| SMILES | OO.OO.[NH3+][C@@H](Cc1ccc(O)cc1)C(=O)[O-] |
| InChI | InChI=1S/C9H11NO3.2H2O2/c10-8(9(12)13)5-6-1-3-7(11)4-2-6;2*1-2/h1-4,8,11H,5,10H2,(H,12,13);2*1-2H/t8-;;/m0../s1 |
| InChIKey | NRYGHSUCPIBRJV-JZGIKJSDSA-N |
| XLogP | -1.67 |
| TPSA | 168.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.22 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|