C13H15NO4 — CID 58271791
(2S)-2-azaniumyl-3-[4-(2,3-dioxobutyl)phenyl]propanoate (PubChem CID 58271791) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is (2S)-2-azaniumyl-3-[4-(2,3-dioxobutyl)phenyl]propanoate.
| Compound Name | (2S)-2-azaniumyl-3-[4-(2,3-dioxobutyl)phenyl]propanoate |
|---|---|
| PubChem CID | 58271791 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | (2S)-2-azaniumyl-3-[4-(2,3-dioxobutyl)phenyl]propanoate |
| SMILES | CC(=O)C(=O)Cc1ccc(C[C@H]([NH3+])C(=O)[O-])cc1 |
| InChI | InChI=1S/C13H15NO4/c1-8(15)12(16)7-10-4-2-9(3-5-10)6-11(14)13(17)18/h2-5,11H,6-7,14H2,1H3,(H,17,18)/t11-/m0/s1 |
| InChIKey | WPEVQBBJASPKLX-NSHDSACASA-N |
| XLogP | -1.71 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|