C10H9FO2 — CID 83696223
1-(4-fluorophenyl)butane-2,3-dione (PubChem CID 83696223) has the molecular formula C10H9FO2 and a molecular weight of 180.18 g/mol. Its IUPAC name is 1-(4-fluorophenyl)butane-2,3-dione.
| Compound Name | 1-(4-fluorophenyl)butane-2,3-dione |
|---|---|
| PubChem CID | 83696223 |
| Molecular Formula | C10H9FO2 |
| Molecular Weight | 180.18 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | 1-(4-fluorophenyl)butane-2,3-dione |
| SMILES | CC(=O)C(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C10H9FO2/c1-7(12)10(13)6-8-2-4-9(11)5-3-8/h2-5H,6H2,1H3 |
| InChIKey | NRXWVKWTGXTHSS-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.18 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|