C11H12O4 — CID 141216254
1-[4-(hydroxymethoxy)phenyl]butane-2,3-dione (PubChem CID 141216254) has the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. Its IUPAC name is 1-[4-(hydroxymethoxy)phenyl]butane-2,3-dione.
| Compound Name | 1-[4-(hydroxymethoxy)phenyl]butane-2,3-dione |
|---|---|
| PubChem CID | 141216254 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 1-[4-(hydroxymethoxy)phenyl]butane-2,3-dione |
| SMILES | CC(=O)C(=O)Cc1ccc(OCO)cc1 |
| InChI | InChI=1S/C11H12O4/c1-8(13)11(14)6-9-2-4-10(5-3-9)15-7-12/h2-5,12H,6-7H2,1H3 |
| InChIKey | ZVLBJBWQFHKITO-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|