C11H10F4O — CID 64565924
5,5,5-trifluoro-1-(4-fluorophenyl)pentan-2-one (PubChem CID 64565924) has the molecular formula C11H10F4O and a molecular weight of 234.19 g/mol. Its IUPAC name is 5,5,5-trifluoro-1-(4-fluorophenyl)pentan-2-one.
| Compound Name | 5,5,5-trifluoro-1-(4-fluorophenyl)pentan-2-one |
|---|---|
| PubChem CID | 64565924 |
| Molecular Formula | C11H10F4O |
| Molecular Weight | 234.19 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 5,5,5-trifluoro-1-(4-fluorophenyl)pentan-2-one |
| SMILES | O=C(CCC(F)(F)F)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C11H10F4O/c12-9-3-1-8(2-4-9)7-10(16)5-6-11(13,14)15/h1-4H,5-7H2 |
| InChIKey | NKZLRABDQPYBIX-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.19 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |