C22H30O4 — CID 10291911
6-[4-(5,5-dimethyl-2,6-dioxohexyl)phenyl]-2,2-dimethyl-5-oxohexanal (PubChem CID 10291911) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is 6-[4-(5,5-dimethyl-2,6-dioxohexyl)phenyl]-2,2-dimethyl-5-oxohexanal.
| Compound Name | 6-[4-(5,5-dimethyl-2,6-dioxohexyl)phenyl]-2,2-dimethyl-5-oxohexanal |
|---|---|
| PubChem CID | 10291911 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | 6-[4-(5,5-dimethyl-2,6-dioxohexyl)phenyl]-2,2-dimethyl-5-oxohexanal |
| SMILES | CC(C)(C=O)CCC(=O)Cc1ccc(CC(=O)CCC(C)(C)C=O)cc1 |
| InChI | InChI=1S/C22H30O4/c1-21(2,15-23)11-9-19(25)13-17-5-7-18(8-6-17)14-20(26)10-12-22(3,4)16-24/h5-8,15-16H,9-14H2,1-4H3 |
| InChIKey | LPADBQJKDUPBHS-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|