C16H24O — CID 62901853
1-(3,4-dimethylphenyl)-5,5-dimethylhexan-2-one (PubChem CID 62901853) has the molecular formula C16H24O and a molecular weight of 232.37 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-5,5-dimethylhexan-2-one.
| Compound Name | 1-(3,4-dimethylphenyl)-5,5-dimethylhexan-2-one |
|---|---|
| PubChem CID | 62901853 |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-5,5-dimethylhexan-2-one |
| SMILES | Cc1ccc(CC(=O)CCC(C)(C)C)cc1C |
| InChI | InChI=1S/C16H24O/c1-12-6-7-14(10-13(12)2)11-15(17)8-9-16(3,4)5/h6-7,10H,8-9,11H2,1-5H3 |
| InChIKey | HTISSSMRJKUAGS-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |