C18H29NO — CID 116582921
5-(2-aminoethyl)-1-(3,4-dimethylphenyl)octan-2-one (PubChem CID 116582921) has the molecular formula C18H29NO and a molecular weight of 275.44 g/mol. Its IUPAC name is 5-(2-aminoethyl)-1-(3,4-dimethylphenyl)octan-2-one.
| Compound Name | 5-(2-aminoethyl)-1-(3,4-dimethylphenyl)octan-2-one |
|---|---|
| PubChem CID | 116582921 |
| Molecular Formula | C18H29NO |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.22 |
| IUPAC Name | 5-(2-aminoethyl)-1-(3,4-dimethylphenyl)octan-2-one |
| SMILES | CCCC(CCN)CCC(=O)Cc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C18H29NO/c1-4-5-16(10-11-19)8-9-18(20)13-17-7-6-14(2)15(3)12-17/h6-7,12,16H,4-5,8-11,13,19H2,1-3H3 |
| InChIKey | RQDNEHBWYVLIMZ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |