C17H22O4 — CID 143079817
methyl 2,2-dimethyl-5-oxo-6-[4-(2-oxoethyl)phenyl]hexanoate (PubChem CID 143079817) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is methyl 2,2-dimethyl-5-oxo-6-[4-(2-oxoethyl)phenyl]hexanoate.
| Compound Name | methyl 2,2-dimethyl-5-oxo-6-[4-(2-oxoethyl)phenyl]hexanoate |
|---|---|
| PubChem CID | 143079817 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | methyl 2,2-dimethyl-5-oxo-6-[4-(2-oxoethyl)phenyl]hexanoate |
| SMILES | COC(=O)C(C)(C)CCC(=O)Cc1ccc(CC=O)cc1 |
| InChI | InChI=1S/C17H22O4/c1-17(2,16(20)21-3)10-8-15(19)12-14-6-4-13(5-7-14)9-11-18/h4-7,11H,8-10,12H2,1-3H3 |
| InChIKey | LSHNDTBVVBLARX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|