C24H34O6 — CID 174436867
[4-(6-methoxy-5,5-dimethyl-2,6-dioxohexyl)phenyl] 2,2,5-trimethyl-6-oxohexanoate (PubChem CID 174436867) has the molecular formula C24H34O6 and a molecular weight of 418.53 g/mol. Its IUPAC name is [4-(6-methoxy-5,5-dimethyl-2,6-dioxohexyl)phenyl] 2,2,5-trimethyl-6-oxohexanoate.
| Compound Name | [4-(6-methoxy-5,5-dimethyl-2,6-dioxohexyl)phenyl] 2,2,5-trimethyl-6-oxohexanoate |
|---|---|
| PubChem CID | 174436867 |
| Molecular Formula | C24H34O6 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | [4-(6-methoxy-5,5-dimethyl-2,6-dioxohexyl)phenyl] 2,2,5-trimethyl-6-oxohexanoate |
| SMILES | COC(=O)C(C)(C)CCC(=O)Cc1ccc(OC(=O)C(C)(C)CCC(C)C=O)cc1 |
| InChI | InChI=1S/C24H34O6/c1-17(16-25)11-13-24(4,5)22(28)30-20-9-7-18(8-10-20)15-19(26)12-14-23(2,3)21(27)29-6/h7-10,16-17H,11-15H2,1-6H3 |
| InChIKey | WXDDQHVZLHPGDZ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|