C19H30O4 — CID 143947797
[4-(methoxymethyl)phenyl] 5-ethoxy-2,2,5-trimethylhexanoate (PubChem CID 143947797) has the molecular formula C19H30O4 and a molecular weight of 322.45 g/mol. Its IUPAC name is [4-(methoxymethyl)phenyl] 5-ethoxy-2,2,5-trimethylhexanoate.
| Compound Name | [4-(methoxymethyl)phenyl] 5-ethoxy-2,2,5-trimethylhexanoate |
|---|---|
| PubChem CID | 143947797 |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | [4-(methoxymethyl)phenyl] 5-ethoxy-2,2,5-trimethylhexanoate |
| SMILES | CCOC(C)(C)CCC(C)(C)C(=O)Oc1ccc(COC)cc1 |
| InChI | InChI=1S/C19H30O4/c1-7-22-19(4,5)13-12-18(2,3)17(20)23-16-10-8-15(9-11-16)14-21-6/h8-11H,7,12-14H2,1-6H3 |
| InChIKey | JEIPJENSSQLLGI-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|