C15H22O3 — CID 123232470
[4-(2-hydroxypropan-2-yl)phenyl] 2,2-dimethylbutanoate (PubChem CID 123232470) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is [4-(2-hydroxypropan-2-yl)phenyl] 2,2-dimethylbutanoate.
| Compound Name | [4-(2-hydroxypropan-2-yl)phenyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 123232470 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | [4-(2-hydroxypropan-2-yl)phenyl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)Oc1ccc(C(C)(C)O)cc1 |
| InChI | InChI=1S/C15H22O3/c1-6-14(2,3)13(16)18-12-9-7-11(8-10-12)15(4,5)17/h7-10,17H,6H2,1-5H3 |
| InChIKey | HZHCTYCQBQDGDQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|