C20H24O3 — CID 130261506
[4-[hydroxy-(4-methylphenyl)methyl]phenyl] 2,2-dimethylbutanoate (PubChem CID 130261506) has the molecular formula C20H24O3 and a molecular weight of 312.41 g/mol. Its IUPAC name is [4-[hydroxy-(4-methylphenyl)methyl]phenyl] 2,2-dimethylbutanoate.
| Compound Name | [4-[hydroxy-(4-methylphenyl)methyl]phenyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 130261506 |
| Molecular Formula | C20H24O3 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | [4-[hydroxy-(4-methylphenyl)methyl]phenyl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)Oc1ccc(C(O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C20H24O3/c1-5-20(3,4)19(22)23-17-12-10-16(11-13-17)18(21)15-8-6-14(2)7-9-15/h6-13,18,21H,5H2,1-4H3 |
| InChIKey | VZRAJOPBIVEEDH-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|