C23H30O2 — CID 89035764
[4-(4-methylphenyl)phenyl] 2-ethyl-2,4,4-trimethylpentanoate (PubChem CID 89035764) has the molecular formula C23H30O2 and a molecular weight of 338.49 g/mol. Its IUPAC name is [4-(4-methylphenyl)phenyl] 2-ethyl-2,4,4-trimethylpentanoate.
| Compound Name | [4-(4-methylphenyl)phenyl] 2-ethyl-2,4,4-trimethylpentanoate |
|---|---|
| PubChem CID | 89035764 |
| Molecular Formula | C23H30O2 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | [4-(4-methylphenyl)phenyl] 2-ethyl-2,4,4-trimethylpentanoate |
| SMILES | CCC(C)(CC(C)(C)C)C(=O)Oc1ccc(-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C23H30O2/c1-7-23(6,16-22(3,4)5)21(24)25-20-14-12-19(13-15-20)18-10-8-17(2)9-11-18/h8-15H,7,16H2,1-6H3 |
| InChIKey | VJBRVYVLBSRKCQ-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|