C27H38O3 — CID 129110303
[4-[1-[4-(3-methylpentan-3-yloxy)phenyl]ethyl]phenyl] 2-ethyl-2-methylbutanoate (PubChem CID 129110303) has the molecular formula C27H38O3 and a molecular weight of 410.60 g/mol. Its IUPAC name is [4-[1-[4-(3-methylpentan-3-yloxy)phenyl]ethyl]phenyl] 2-ethyl-2-methylbutanoate.
| Compound Name | [4-[1-[4-(3-methylpentan-3-yloxy)phenyl]ethyl]phenyl] 2-ethyl-2-methylbutanoate |
|---|---|
| PubChem CID | 129110303 |
| Molecular Formula | C27H38O3 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.28 |
| IUPAC Name | [4-[1-[4-(3-methylpentan-3-yloxy)phenyl]ethyl]phenyl] 2-ethyl-2-methylbutanoate |
| SMILES | CCC(C)(CC)Oc1ccc(C(C)c2ccc(OC(=O)C(C)(CC)CC)cc2)cc1 |
| InChI | InChI=1S/C27H38O3/c1-8-26(6,9-2)25(28)29-23-16-12-21(13-17-23)20(5)22-14-18-24(19-15-22)30-27(7,10-3)11-4/h12-20H,8-11H2,1-7H3 |
| InChIKey | KLQNRLKMXPVSBU-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|