C26H36O3 — CID 154933475
[4-[3-[4-[(2-methylpropan-2-yl)oxy]phenyl]pentan-3-yl]phenyl] 2,2-dimethylpropanoate (PubChem CID 154933475) has the molecular formula C26H36O3 and a molecular weight of 396.57 g/mol. Its IUPAC name is [4-[3-[4-[(2-methylpropan-2-yl)oxy]phenyl]pentan-3-yl]phenyl] 2,2-dimethylpropanoate.
| Compound Name | [4-[3-[4-[(2-methylpropan-2-yl)oxy]phenyl]pentan-3-yl]phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 154933475 |
| Molecular Formula | C26H36O3 |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.27 |
| IUPAC Name | [4-[3-[4-[(2-methylpropan-2-yl)oxy]phenyl]pentan-3-yl]phenyl] 2,2-dimethylpropanoate |
| SMILES | CCC(CC)(c1ccc(OC(=O)C(C)(C)C)cc1)c1ccc(OC(C)(C)C)cc1 |
| InChI | InChI=1S/C26H36O3/c1-9-26(10-2,20-13-17-22(18-14-20)29-25(6,7)8)19-11-15-21(16-12-19)28-23(27)24(3,4)5/h11-18H,9-10H2,1-8H3 |
| InChIKey | UFXSIGCEAGXXQJ-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|